C19H16N4O2S — CID 27691817
N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-1H-indole-3-carbohydrazide (PubChem CID 27691817) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 27691817 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-1H-indole-3-carbohydrazide |
| SMILES | O=C(CCc1nc2ccccc2s1)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N4O2S/c24-17(9-10-18-21-15-7-3-4-8-16(15)26-18)22-23-19(25)13-11-20-14-6-2-1-5-12(13)14/h1-8,11,20H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | UPCNZWAGLAXDNO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|