C14H17N3O2 — CID 134008164
N'-pentanoyl-1H-indole-3-carbohydrazide (PubChem CID 134008164) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N'-pentanoyl-1H-indole-3-carbohydrazide.
| Compound Name | N'-pentanoyl-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 134008164 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N'-pentanoyl-1H-indole-3-carbohydrazide |
| SMILES | CCCCC(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H17N3O2/c1-2-3-8-13(18)16-17-14(19)11-9-15-12-7-5-4-6-10(11)12/h4-7,9,15H,2-3,8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | JVXQFJWACZVQOF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|