C19H17N3O3 — CID 27691367
N'-(4-oxo-4-phenylbutanoyl)-1H-indole-3-carbohydrazide (PubChem CID 27691367) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N'-(4-oxo-4-phenylbutanoyl)-1H-indole-3-carbohydrazide.
| Compound Name | N'-(4-oxo-4-phenylbutanoyl)-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 27691367 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N'-(4-oxo-4-phenylbutanoyl)-1H-indole-3-carbohydrazide |
| SMILES | O=C(CCC(=O)c1ccccc1)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N3O3/c23-17(13-6-2-1-3-7-13)10-11-18(24)21-22-19(25)15-12-20-16-9-5-4-8-14(15)16/h1-9,12,20H,10-11H2,(H,21,24)(H,22,25) |
| InChIKey | AMFHPUBXIOQOEO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|