C19H17Cl2N3O2 — CID 55821579
N'-[4-(3,4-dichlorophenyl)butanoyl]-1H-indole-3-carbohydrazide (PubChem CID 55821579) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is N'-[4-(3,4-dichlorophenyl)butanoyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[4-(3,4-dichlorophenyl)butanoyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 55821579 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N'-[4-(3,4-dichlorophenyl)butanoyl]-1H-indole-3-carbohydrazide |
| SMILES | O=C(CCCc1ccc(Cl)c(Cl)c1)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17Cl2N3O2/c20-15-9-8-12(10-16(15)21)4-3-7-18(25)23-24-19(26)14-11-22-17-6-2-1-5-13(14)17/h1-2,5-6,8-11,22H,3-4,7H2,(H,23,25)(H,24,26) |
| InChIKey | QZZSGZZZQZYVLM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|