C21H23N3O4 — CID 78800173
N'-[4-(2-ethoxyphenoxy)butanoyl]-1H-indole-3-carbohydrazide (PubChem CID 78800173) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N'-[4-(2-ethoxyphenoxy)butanoyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[4-(2-ethoxyphenoxy)butanoyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 78800173 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N'-[4-(2-ethoxyphenoxy)butanoyl]-1H-indole-3-carbohydrazide |
| SMILES | CCOc1ccccc1OCCCC(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H23N3O4/c1-2-27-18-10-5-6-11-19(18)28-13-7-12-20(25)23-24-21(26)16-14-22-17-9-4-3-8-15(16)17/h3-6,8-11,14,22H,2,7,12-13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | OLEAZGKGMXACJE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|