C22H22N4O6 — CID 55786955
N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 55786955) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 55786955 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)CNC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C22H22N4O6/c1-2-31-17-9-5-6-10-18(17)32-13-20(28)26-25-19(27)12-24-22(30)15-11-23-16-8-4-3-7-14(16)21(15)29/h3-11H,2,12-13H2,1H3,(H,23,29)(H,24,30)(H,25,27)(H,26,28) |
| InChIKey | JWBUQGDLYCMFJQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|