C26H23N3O5 — CID 66676219
[4-(2-ethoxyphenyl)-3-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]methylcarbamic acid (PubChem CID 66676219) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is [4-(2-ethoxyphenyl)-3-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]methylcarbamic acid.
| Compound Name | [4-(2-ethoxyphenyl)-3-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 66676219 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [4-(2-ethoxyphenyl)-3-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]methylcarbamic acid |
| SMILES | CCOc1ccccc1-c1ccc(CNC(=O)O)cc1NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C26H23N3O5/c1-2-34-23-10-6-4-7-18(23)17-12-11-16(14-28-26(32)33)13-22(17)29-25(31)20-15-27-21-9-5-3-8-19(21)24(20)30/h3-13,15,28H,2,14H2,1H3,(H,27,30)(H,29,31)(H,32,33) |
| InChIKey | KQUATZNEZSOVFM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |