C16H10F2N2O2 — CID 30131667
N-(2,5-difluorophenyl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 30131667) has the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 30131667 |
| Molecular Formula | C16H10F2N2O2 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C16H10F2N2O2/c17-9-5-6-12(18)14(7-9)20-16(22)11-8-19-13-4-2-1-3-10(13)15(11)21/h1-8H,(H,19,21)(H,20,22) |
| InChIKey | DNYAOCZFZIPCCR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |