C15H9ClF2N2O — CID 113205928
5-chloro-N-(2,4-difluorophenyl)-1H-indole-3-carboxamide (PubChem CID 113205928) has the molecular formula C15H9ClF2N2O and a molecular weight of 306.70 g/mol. Its IUPAC name is 5-chloro-N-(2,4-difluorophenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-chloro-N-(2,4-difluorophenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113205928 |
| Molecular Formula | C15H9ClF2N2O |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-chloro-N-(2,4-difluorophenyl)-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H9ClF2N2O/c16-8-1-3-13-10(5-8)11(7-19-13)15(21)20-14-4-2-9(17)6-12(14)18/h1-7,19H,(H,20,21) |
| InChIKey | KNWBKGQSUUDGEB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |