C16H9F3N2O2 — CID 39849781
N-(2,4-difluorophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 39849781) has the molecular formula C16H9F3N2O2 and a molecular weight of 318.25 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 39849781 |
| Molecular Formula | C16H9F3N2O2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-fluoro-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1c[nH]c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C16H9F3N2O2/c17-8-1-3-13-10(5-8)15(22)11(7-20-13)16(23)21-14-4-2-9(18)6-12(14)19/h1-7H,(H,20,22)(H,21,23) |
| InChIKey | HZDFFZIGXHVUSQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |