C20H16F4N2O2 — CID 53245935
6-fluoro-4-oxo-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxamide (PubChem CID 53245935) has the molecular formula C20H16F4N2O2 and a molecular weight of 392.35 g/mol. Its IUPAC name is 6-fluoro-4-oxo-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxamide.
| Compound Name | 6-fluoro-4-oxo-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 53245935 |
| Molecular Formula | C20H16F4N2O2 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 6-fluoro-4-oxo-N-[4-propan-2-yl-2-(trifluoromethyl)phenyl]-1H-quinoline-3-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2c[nH]c3ccc(F)cc3c2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F4N2O2/c1-10(2)11-3-5-17(15(7-11)20(22,23)24)26-19(28)14-9-25-16-6-4-12(21)8-13(16)18(14)27/h3-10H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | QXJMRXYJNJWHHO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |