C24H23F3N3O2+ — CID 163549023
N-[4-(7-methyl-7-azoniabicyclo[2.2.1]heptan-7-yl)-2-(trifluoromethyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 163549023) has the molecular formula C24H23F3N3O2+ and a molecular weight of 442.46 g/mol. Its IUPAC name is N-[4-(7-methyl-7-azoniabicyclo[2.2.1]heptan-7-yl)-2-(trifluoromethyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[4-(7-methyl-7-azoniabicyclo[2.2.1]heptan-7-yl)-2-(trifluoromethyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 163549023 |
| Molecular Formula | C24H23F3N3O2+ |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[4-(7-methyl-7-azoniabicyclo[2.2.1]heptan-7-yl)-2-(trifluoromethyl)phenyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | C[N+]1(c2ccc(NC(=O)c3c[nH]c4ccccc4c3=O)c(C(F)(F)F)c2)C2CCC1CC2 |
| InChI | InChI=1S/C24H22F3N3O2/c1-30(14-6-7-15(30)9-8-14)16-10-11-21(19(12-16)24(25,26)27)29-23(32)18-13-28-20-5-3-2-4-17(20)22(18)31/h2-5,10-15H,6-9H2,1H3,(H-,28,29,31,32)/p+1 |
| InChIKey | IYPCLKWHAGSSPG-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|