C17H12F3N3O3 — CID 139455131
N-[4-amino-2-(trifluoromethyl)phenyl]-5-hydroxy-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 139455131) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is N-[4-amino-2-(trifluoromethyl)phenyl]-5-hydroxy-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[4-amino-2-(trifluoromethyl)phenyl]-5-hydroxy-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 139455131 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[4-amino-2-(trifluoromethyl)phenyl]-5-hydroxy-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2c[nH]c3cccc(O)c3c2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N3O3/c18-17(19,20)10-6-8(21)4-5-11(10)23-16(26)9-7-22-12-2-1-3-13(24)14(12)15(9)25/h1-7,24H,21H2,(H,22,25)(H,23,26) |
| InChIKey | LHILTSPFTUPDGW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|