C12H8F3NO2 — CID 58281407
3-acetyl-5-(trifluoromethyl)-1H-quinolin-4-one (PubChem CID 58281407) has the molecular formula C12H8F3NO2 and a molecular weight of 255.19 g/mol. Its IUPAC name is 3-acetyl-5-(trifluoromethyl)-1H-quinolin-4-one.
| Compound Name | 3-acetyl-5-(trifluoromethyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 58281407 |
| Molecular Formula | C12H8F3NO2 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 3-acetyl-5-(trifluoromethyl)-1H-quinolin-4-one |
| SMILES | CC(=O)c1c[nH]c2cccc(C(F)(F)F)c2c1=O |
| InChI | InChI=1S/C12H8F3NO2/c1-6(17)7-5-16-9-4-2-3-8(12(13,14)15)10(9)11(7)18/h2-5H,1H3,(H,16,18) |
| InChIKey | UVSGQQQNSYPJFO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |