C12H5F6NO3 — CID 2736158
4-oxo-5,7-bis(trifluoromethyl)-1H-quinoline-3-carboxylic acid (PubChem CID 2736158) has the molecular formula C12H5F6NO3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 4-oxo-5,7-bis(trifluoromethyl)-1H-quinoline-3-carboxylic acid.
| Compound Name | 4-oxo-5,7-bis(trifluoromethyl)-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 2736158 |
| Molecular Formula | C12H5F6NO3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 4-oxo-5,7-bis(trifluoromethyl)-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2cc(C(F)(F)F)cc(C(F)(F)F)c2c1=O |
| InChI | InChI=1S/C12H5F6NO3/c13-11(14,15)4-1-6(12(16,17)18)8-7(2-4)19-3-5(9(8)20)10(21)22/h1-3H,(H,19,20)(H,21,22) |
| InChIKey | DCWNMQCUGHBNRZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |