C16H9BrF3NO2S — CID 175932799
6-bromo-3-[4-(trifluoromethyl)phenyl]sulfanyl-1H-indole-4-carboxylic acid (PubChem CID 175932799) has the molecular formula C16H9BrF3NO2S and a molecular weight of 416.22 g/mol. Its IUPAC name is 6-bromo-3-[4-(trifluoromethyl)phenyl]sulfanyl-1H-indole-4-carboxylic acid.
| Compound Name | 6-bromo-3-[4-(trifluoromethyl)phenyl]sulfanyl-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 175932799 |
| Molecular Formula | C16H9BrF3NO2S |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | 6-bromo-3-[4-(trifluoromethyl)phenyl]sulfanyl-1H-indole-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Br)cc2[nH]cc(Sc3ccc(C(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C16H9BrF3NO2S/c17-9-5-11(15(22)23)14-12(6-9)21-7-13(14)24-10-3-1-8(2-4-10)16(18,19)20/h1-7,21H,(H,22,23) |
| InChIKey | GKGJIDDCEDBMLO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |