C13H9BrF3NO2S2 — CID 23546051
2-(4-bromophenyl)sulfanyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 23546051) has the molecular formula C13H9BrF3NO2S2 and a molecular weight of 412.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23546051 |
| Molecular Formula | C13H9BrF3NO2S2 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(F)(F)F)ccc1Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H9BrF3NO2S2/c14-9-2-4-10(5-3-9)21-11-6-1-8(13(15,16)17)7-12(11)22(18,19)20/h1-7H,(H2,18,19,20) |
| InChIKey | BZPUNIQBXNKNSH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |