C12H10F2N2O2S2 — CID 78985067
5-amino-2-(3,4-difluorophenyl)sulfanylbenzenesulfonamide (PubChem CID 78985067) has the molecular formula C12H10F2N2O2S2 and a molecular weight of 316.35 g/mol. Its IUPAC name is 5-amino-2-(3,4-difluorophenyl)sulfanylbenzenesulfonamide.
| Compound Name | 5-amino-2-(3,4-difluorophenyl)sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 78985067 |
| Molecular Formula | C12H10F2N2O2S2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 5-amino-2-(3,4-difluorophenyl)sulfanylbenzenesulfonamide |
| SMILES | Nc1ccc(Sc2ccc(F)c(F)c2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H10F2N2O2S2/c13-9-3-2-8(6-10(9)14)19-11-4-1-7(15)5-12(11)20(16,17)18/h1-6H,15H2,(H2,16,17,18) |
| InChIKey | HZHYTHWJVGBUQJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|