C12H7F4NS — CID 115507603
2-(3,4-difluorophenyl)sulfanyl-4,6-difluoroaniline (PubChem CID 115507603) has the molecular formula C12H7F4NS and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-4,6-difluoroaniline.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-4,6-difluoroaniline |
|---|---|
| PubChem CID | 115507603 |
| Molecular Formula | C12H7F4NS |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-4,6-difluoroaniline |
| SMILES | Nc1c(F)cc(F)cc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H7F4NS/c13-6-3-10(16)12(17)11(4-6)18-7-1-2-8(14)9(15)5-7/h1-5H,17H2 |
| InChIKey | DPPMEDMTPFTSHA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|