C7H7F2NS — CID 115507618
2,4-difluoro-6-methylsulfanylaniline (PubChem CID 115507618) has the molecular formula C7H7F2NS and a molecular weight of 175.20 g/mol. Its IUPAC name is 2,4-difluoro-6-methylsulfanylaniline.
| Compound Name | 2,4-difluoro-6-methylsulfanylaniline |
|---|---|
| PubChem CID | 115507618 |
| Molecular Formula | C7H7F2NS |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 2,4-difluoro-6-methylsulfanylaniline |
| SMILES | CSc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C7H7F2NS/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,10H2,1H3 |
| InChIKey | DJAGWMKDZQDHMM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|