C9H7F2N — CID 130019414
2,4-difluoro-6-prop-1-ynylaniline (PubChem CID 130019414) has the molecular formula C9H7F2N and a molecular weight of 167.16 g/mol. Its IUPAC name is 2,4-difluoro-6-prop-1-ynylaniline.
| Compound Name | 2,4-difluoro-6-prop-1-ynylaniline |
|---|---|
| PubChem CID | 130019414 |
| Molecular Formula | C9H7F2N |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2,4-difluoro-6-prop-1-ynylaniline |
| SMILES | CC#Cc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C9H7F2N/c1-2-3-6-4-7(10)5-8(11)9(6)12/h4-5H,12H2,1H3 |
| InChIKey | JKAGCKNIYKNXFR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|