C10H6F2N2 — CID 170474860
4-(2-amino-3,5-difluorophenyl)but-3-ynenitrile (PubChem CID 170474860) has the molecular formula C10H6F2N2 and a molecular weight of 192.17 g/mol. Its IUPAC name is 4-(2-amino-3,5-difluorophenyl)but-3-ynenitrile.
| Compound Name | 4-(2-amino-3,5-difluorophenyl)but-3-ynenitrile |
|---|---|
| PubChem CID | 170474860 |
| Molecular Formula | C10H6F2N2 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-(2-amino-3,5-difluorophenyl)but-3-ynenitrile |
| SMILES | N#CCC#Cc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C10H6F2N2/c11-8-5-7(3-1-2-4-13)10(14)9(12)6-8/h5-6H,2,14H2 |
| InChIKey | RGOCVUALIVPAGZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|