C10H7F2N3OS — CID 115507599
2-(2-amino-3,5-difluorophenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 115507599) has the molecular formula C10H7F2N3OS and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-(2-amino-3,5-difluorophenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-(2-amino-3,5-difluorophenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 115507599 |
| Molecular Formula | C10H7F2N3OS |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-(2-amino-3,5-difluorophenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1c(F)cc(F)cc1Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C10H7F2N3OS/c11-5-3-6(12)9(13)7(4-5)17-10-14-2-1-8(16)15-10/h1-4H,13H2,(H,14,15,16) |
| InChIKey | JLEQSWQRGSXFOP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|