C10H8FN3OS — CID 60790080
2-(2-amino-3-fluorophenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 60790080) has the molecular formula C10H8FN3OS and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(2-amino-3-fluorophenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-(2-amino-3-fluorophenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 60790080 |
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-(2-amino-3-fluorophenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1c(F)cccc1Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C10H8FN3OS/c11-6-2-1-3-7(9(6)12)16-10-13-5-4-8(15)14-10/h1-5H,12H2,(H,13,14,15) |
| InChIKey | SFBCRLKLUNHCBU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|