C13H10FN3OS2 — CID 79148133
7-[(2-amino-5-fluorophenyl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 79148133) has the molecular formula C13H10FN3OS2 and a molecular weight of 307.38 g/mol. Its IUPAC name is 7-[(2-amino-5-fluorophenyl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[(2-amino-5-fluorophenyl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 79148133 |
| Molecular Formula | C13H10FN3OS2 |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 7-[(2-amino-5-fluorophenyl)sulfanylmethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Nc1ccc(F)cc1SCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C13H10FN3OS2/c14-8-1-2-10(15)11(5-8)20-7-9-6-12(18)17-3-4-19-13(17)16-9/h1-6H,7,15H2 |
| InChIKey | KEAPYCNSDKFBHX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|