C10H14F2N2 — CID 115506451
1-N-butan-2-yl-3,5-difluorobenzene-1,2-diamine (PubChem CID 115506451) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-N-butan-2-yl-3,5-difluorobenzene-1,2-diamine.
| Compound Name | 1-N-butan-2-yl-3,5-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115506451 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-N-butan-2-yl-3,5-difluorobenzene-1,2-diamine |
| SMILES | CCC(C)Nc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C10H14F2N2/c1-3-6(2)14-9-5-7(11)4-8(12)10(9)13/h4-6,14H,3,13H2,1-2H3 |
| InChIKey | IUGWKQQBLLOLLW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|