C10H13F2N — CID 43196032
N-butan-2-yl-3,5-difluoroaniline (PubChem CID 43196032) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is N-butan-2-yl-3,5-difluoroaniline.
| Compound Name | N-butan-2-yl-3,5-difluoroaniline |
|---|---|
| PubChem CID | 43196032 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-butan-2-yl-3,5-difluoroaniline |
| SMILES | CCC(C)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H13F2N/c1-3-7(2)13-10-5-8(11)4-9(12)6-10/h4-7,13H,3H2,1-2H3 |
| InChIKey | COMRVYVDRZFPOL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |