C10H11F4N — CID 107644089
N-butan-2-yl-2,3,5,6-tetrafluoroaniline (PubChem CID 107644089) has the molecular formula C10H11F4N and a molecular weight of 221.20 g/mol. Its IUPAC name is N-butan-2-yl-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-butan-2-yl-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107644089 |
| Molecular Formula | C10H11F4N |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N-butan-2-yl-2,3,5,6-tetrafluoroaniline |
| SMILES | CCC(C)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H11F4N/c1-3-5(2)15-10-8(13)6(11)4-7(12)9(10)14/h4-5,15H,3H2,1-2H3 |
| InChIKey | XFQCHFRSMYWIJY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|