C15H21F4N — CID 107643577
2,3,5,6-tetrafluoro-N-nonan-2-ylaniline (PubChem CID 107643577) has the molecular formula C15H21F4N and a molecular weight of 291.33 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-nonan-2-ylaniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-nonan-2-ylaniline |
|---|---|
| PubChem CID | 107643577 |
| Molecular Formula | C15H21F4N |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-nonan-2-ylaniline |
| SMILES | CCCCCCCC(C)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C15H21F4N/c1-3-4-5-6-7-8-10(2)20-15-13(18)11(16)9-12(17)14(15)19/h9-10,20H,3-8H2,1-2H3 |
| InChIKey | NXXNJJVRTXUXGT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|