C13H19F2N — CID 43123890
2,6-difluoro-N-heptan-2-ylaniline (PubChem CID 43123890) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 2,6-difluoro-N-heptan-2-ylaniline.
| Compound Name | 2,6-difluoro-N-heptan-2-ylaniline |
|---|---|
| PubChem CID | 43123890 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,6-difluoro-N-heptan-2-ylaniline |
| SMILES | CCCCCC(C)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H19F2N/c1-3-4-5-7-10(2)16-13-11(14)8-6-9-12(13)15/h6,8-10,16H,3-5,7H2,1-2H3 |
| InChIKey | CTCHMLUMARSHQM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|