C14H21Cl2N — CID 65469716
2,6-dichloro-N-octan-2-ylaniline (PubChem CID 65469716) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is 2,6-dichloro-N-octan-2-ylaniline.
| Compound Name | 2,6-dichloro-N-octan-2-ylaniline |
|---|---|
| PubChem CID | 65469716 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2,6-dichloro-N-octan-2-ylaniline |
| SMILES | CCCCCCC(C)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H21Cl2N/c1-3-4-5-6-8-11(2)17-14-12(15)9-7-10-13(14)16/h7,9-11,17H,3-6,8H2,1-2H3 |
| InChIKey | BCLXCWFKZUEOAQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|