C15H23Cl2N — CID 55199203
3,5-dichloro-N-nonan-2-ylaniline (PubChem CID 55199203) has the molecular formula C15H23Cl2N and a molecular weight of 288.26 g/mol. Its IUPAC name is 3,5-dichloro-N-nonan-2-ylaniline.
| Compound Name | 3,5-dichloro-N-nonan-2-ylaniline |
|---|---|
| PubChem CID | 55199203 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3,5-dichloro-N-nonan-2-ylaniline |
| SMILES | CCCCCCCC(C)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H23Cl2N/c1-3-4-5-6-7-8-12(2)18-15-10-13(16)9-14(17)11-15/h9-12,18H,3-8H2,1-2H3 |
| InChIKey | NNOHWJTZJVIHLV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|