C16H27Cl2N3O — CID 172781783
(2S)-2-(3,5-dichloroanilino)-N-hexan-2-ylpropanamide;methanamine (PubChem CID 172781783) has the molecular formula C16H27Cl2N3O and a molecular weight of 348.32 g/mol. Its IUPAC name is (2S)-2-(3,5-dichloroanilino)-N-hexan-2-ylpropanamide;methanamine.
| Compound Name | (2S)-2-(3,5-dichloroanilino)-N-hexan-2-ylpropanamide;methanamine |
|---|---|
| PubChem CID | 172781783 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2S)-2-(3,5-dichloroanilino)-N-hexan-2-ylpropanamide;methanamine |
| SMILES | CCCCC(C)NC(=O)[C@H](C)Nc1cc(Cl)cc(Cl)c1.CN |
| InChI | InChI=1S/C15H22Cl2N2O.CH5N/c1-4-5-6-10(2)18-15(20)11(3)19-14-8-12(16)7-13(17)9-14;1-2/h7-11,19H,4-6H2,1-3H3,(H,18,20);2H2,1H3/t10?,11-;/m0./s1 |
| InChIKey | OIYUAHRNKYYFJX-GQNCZFCYSA-N |
| XLogP | 4.06 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |