C15H22Cl2N2O2 — CID 18380247
2-(3,4-dichloroanilino)-N-(1-hydroxyhexan-2-yl)propanamide (PubChem CID 18380247) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-N-(1-hydroxyhexan-2-yl)propanamide.
| Compound Name | 2-(3,4-dichloroanilino)-N-(1-hydroxyhexan-2-yl)propanamide |
|---|---|
| PubChem CID | 18380247 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-(3,4-dichloroanilino)-N-(1-hydroxyhexan-2-yl)propanamide |
| SMILES | CCCCC(CO)NC(=O)C(C)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-3-4-5-12(9-20)19-15(21)10(2)18-11-6-7-13(16)14(17)8-11/h6-8,10,12,18,20H,3-5,9H2,1-2H3,(H,19,21) |
| InChIKey | ADESTHMFYIGPAQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |