C13H16Cl2N2O3 — CID 18380258
methyl 2-[2-(3,4-dichloroanilino)propanoylamino]propanoate (PubChem CID 18380258) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is methyl 2-[2-(3,4-dichloroanilino)propanoylamino]propanoate.
| Compound Name | methyl 2-[2-(3,4-dichloroanilino)propanoylamino]propanoate |
|---|---|
| PubChem CID | 18380258 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | methyl 2-[2-(3,4-dichloroanilino)propanoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)C(C)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-7(12(18)17-8(2)13(19)20-3)16-9-4-5-10(14)11(15)6-9/h4-8,16H,1-3H3,(H,17,18) |
| InChIKey | DDLGGUBDWWLBPB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |