C9H8Cl2NO2- — CID 7855671
(2R)-2-(3,4-dichloroanilino)propanoate (PubChem CID 7855671) has the molecular formula C9H8Cl2NO2- and a molecular weight of 233.07 g/mol. Its IUPAC name is (2R)-2-(3,4-dichloroanilino)propanoate.
| Compound Name | (2R)-2-(3,4-dichloroanilino)propanoate |
|---|---|
| PubChem CID | 7855671 |
| Molecular Formula | C9H8Cl2NO2- |
| Molecular Weight | 233.07 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | (2R)-2-(3,4-dichloroanilino)propanoate |
| SMILES | C[C@@H](Nc1ccc(Cl)c(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C9H9Cl2NO2/c1-5(9(13)14)12-6-2-3-7(10)8(11)4-6/h2-5,12H,1H3,(H,13,14)/p-1/t5-/m1/s1 |
| InChIKey | SUWRMAZHFSUJCB-RXMQYKEDSA-M |
| XLogP | 1.54 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.07 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |