C9H8ClFLiNO2 — CID 69119001
lithium (2S)-2-(3-chloro-4-fluoroanilino)propanoate (PubChem CID 69119001) has the molecular formula C9H8ClFLiNO2 and a molecular weight of 223.56 g/mol. Its IUPAC name is lithium (2S)-2-(3-chloro-4-fluoroanilino)propanoate.
| Compound Name | lithium (2S)-2-(3-chloro-4-fluoroanilino)propanoate |
|---|---|
| PubChem CID | 69119001 |
| Molecular Formula | C9H8ClFLiNO2 |
| Molecular Weight | 223.56 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | lithium (2S)-2-(3-chloro-4-fluoroanilino)propanoate |
| SMILES | C[C@H](Nc1ccc(F)c(Cl)c1)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C9H9ClFNO2.Li/c1-5(9(13)14)12-6-2-3-8(11)7(10)4-6;/h2-5,12H,1H3,(H,13,14);/q;+1/p-1/t5-;/m0./s1 |
| InChIKey | ZMLCAGIIXGCKOJ-JEDNCBNOSA-M |
| XLogP | -1.97 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.56 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |