C9H11Cl2N3O — CID 946902
(2R)-2-(3,4-dichloroanilino)propanehydrazide (PubChem CID 946902) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is (2R)-2-(3,4-dichloroanilino)propanehydrazide.
| Compound Name | (2R)-2-(3,4-dichloroanilino)propanehydrazide |
|---|---|
| PubChem CID | 946902 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (2R)-2-(3,4-dichloroanilino)propanehydrazide |
| SMILES | C[C@@H](Nc1ccc(Cl)c(Cl)c1)C(=O)NN |
| InChI | InChI=1S/C9H11Cl2N3O/c1-5(9(15)14-12)13-6-2-3-7(10)8(11)4-6/h2-5,13H,12H2,1H3,(H,14,15)/t5-/m1/s1 |
| InChIKey | JHOFHSOJIWLDEZ-RXMQYKEDSA-N |
| XLogP | 1.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|