C13H14Cl2N2O3 — CID 10193267
(2S)-2-(3,4-dichloroanilino)-N-(5-oxooxolan-3-yl)propanamide (PubChem CID 10193267) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is (2S)-2-(3,4-dichloroanilino)-N-(5-oxooxolan-3-yl)propanamide.
| Compound Name | (2S)-2-(3,4-dichloroanilino)-N-(5-oxooxolan-3-yl)propanamide |
|---|---|
| PubChem CID | 10193267 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (2S)-2-(3,4-dichloroanilino)-N-(5-oxooxolan-3-yl)propanamide |
| SMILES | C[C@H](Nc1ccc(Cl)c(Cl)c1)C(=O)NC1COC(=O)C1 |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-7(13(19)17-9-5-12(18)20-6-9)16-8-2-3-10(14)11(15)4-8/h2-4,7,9,16H,5-6H2,1H3,(H,17,19)/t7-,9?/m0/s1 |
| InChIKey | RIPUNHSQNXBTRK-JAVCKPHESA-N |
| XLogP | 2.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |