C39H45Cl4N5O4 — CID 67580059
(2S)-2-(3,4-dichloroanilino)-N-hexan-2-ylpropanamide;N-[2-[2-(3,4-dichloroanilino)propanoylamino]-1-hydroxy-2-phenylethyl]benzamide (PubChem CID 67580059) has the molecular formula C39H45Cl4N5O4 and a molecular weight of 789.63 g/mol. Its IUPAC name is (2S)-2-(3,4-dichloroanilino)-N-hexan-2-ylpropanamide;N-[2-[2-(3,4-dichloroanilino)propanoylamino]-1-hydroxy-2-phenylethyl]benzamide.
| Compound Name | (2S)-2-(3,4-dichloroanilino)-N-hexan-2-ylpropanamide;N-[2-[2-(3,4-dichloroanilino)propanoylamino]-1-hydroxy-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 67580059 |
| Molecular Formula | C39H45Cl4N5O4 |
| Molecular Weight | 789.63 g/mol |
| Exact Mass | 787.22 |
| IUPAC Name | (2S)-2-(3,4-dichloroanilino)-N-hexan-2-ylpropanamide;N-[2-[2-(3,4-dichloroanilino)propanoylamino]-1-hydroxy-2-phenylethyl]benzamide |
| SMILES | CC(Nc1ccc(Cl)c(Cl)c1)C(=O)NC(c1ccccc1)C(O)NC(=O)c1ccccc1.CCCCC(C)NC(=O)[C@H](C)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H23Cl2N3O3.C15H22Cl2N2O/c1-15(27-18-12-13-19(25)20(26)14-18)22(30)28-21(16-8-4-2-5-9-16)24(32)29-23(31)17-10-6-3-7-11-17;1-4-5-6-10(2)18-15(20)11(3)19-12-7-8-13(16)14(17)9-12/h2-15,21,24,27,32H,1H3,(H,28,30)(H,29,31);7-11,19H,4-6H2,1-3H3,(H,18,20)/t;10?,11-/m.0/s1 |
| InChIKey | GZDGXKOEADQHPX-JSWAVIPRSA-N |
| XLogP | 8.89 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.63 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|