C13H19Cl2N3O — CID 80697374
1-(1-aminohexan-2-yl)-3-(3,4-dichlorophenyl)urea (PubChem CID 80697374) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is 1-(1-aminohexan-2-yl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(1-aminohexan-2-yl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 80697374 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(1-aminohexan-2-yl)-3-(3,4-dichlorophenyl)urea |
| SMILES | CCCCC(CN)NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2N3O/c1-2-3-4-10(8-16)18-13(19)17-9-5-6-11(14)12(15)7-9/h5-7,10H,2-4,8,16H2,1H3,(H2,17,18,19) |
| InChIKey | WYWPYWJRSKBBRT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |