C17H26ClN3O2 — CID 119668857
N-(1-aminohexan-2-yl)-2-chloro-5-(2-methylpropanoylamino)benzamide (PubChem CID 119668857) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-chloro-5-(2-methylpropanoylamino)benzamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-chloro-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 119668857 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-chloro-5-(2-methylpropanoylamino)benzamide |
| SMILES | CCCCC(CN)NC(=O)c1cc(NC(=O)C(C)C)ccc1Cl |
| InChI | InChI=1S/C17H26ClN3O2/c1-4-5-6-13(10-19)21-17(23)14-9-12(7-8-15(14)18)20-16(22)11(2)3/h7-9,11,13H,4-6,10,19H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | LDGQALIDXFTCCX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |