C18H22ClN5O2 — CID 119668146
3-N-(1-aminohexan-2-yl)-2-N-(4-chlorophenyl)pyrazine-2,3-dicarboxamide (PubChem CID 119668146) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-N-(1-aminohexan-2-yl)-2-N-(4-chlorophenyl)pyrazine-2,3-dicarboxamide.
| Compound Name | 3-N-(1-aminohexan-2-yl)-2-N-(4-chlorophenyl)pyrazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 119668146 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-N-(1-aminohexan-2-yl)-2-N-(4-chlorophenyl)pyrazine-2,3-dicarboxamide |
| SMILES | CCCCC(CN)NC(=O)c1nccnc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN5O2/c1-2-3-4-14(11-20)24-18(26)16-15(21-9-10-22-16)17(25)23-13-7-5-12(19)6-8-13/h5-10,14H,2-4,11,20H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | ZQPLPDARUNTNIU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |