C18H29Cl2N3O2 — CID 119668459
N-[1-(1-aminohexan-2-ylamino)-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide;hydrochloride (PubChem CID 119668459) has the molecular formula C18H29Cl2N3O2 and a molecular weight of 390.36 g/mol. Its IUPAC name is N-[1-(1-aminohexan-2-ylamino)-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide;hydrochloride.
| Compound Name | N-[1-(1-aminohexan-2-ylamino)-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119668459 |
| Molecular Formula | C18H29Cl2N3O2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[1-(1-aminohexan-2-ylamino)-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C(NC(=O)c1ccc(Cl)cc1)C(C)C.Cl |
| InChI | InChI=1S/C18H28ClN3O2.ClH/c1-4-5-6-15(11-20)21-18(24)16(12(2)3)22-17(23)13-7-9-14(19)10-8-13;/h7-10,12,15-16H,4-6,11,20H2,1-3H3,(H,21,24)(H,22,23);1H |
| InChIKey | UMEAESVEHUXGFU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |