C17H18Cl2N2O2 — CID 18380270
2-(3,5-dichloroanilino)-N-(2-hydroxy-1-phenylethyl)propanamide (PubChem CID 18380270) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-N-(2-hydroxy-1-phenylethyl)propanamide.
| Compound Name | 2-(3,5-dichloroanilino)-N-(2-hydroxy-1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 18380270 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-(3,5-dichloroanilino)-N-(2-hydroxy-1-phenylethyl)propanamide |
| SMILES | CC(Nc1cc(Cl)cc(Cl)c1)C(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-11(20-15-8-13(18)7-14(19)9-15)17(23)21-16(10-22)12-5-3-2-4-6-12/h2-9,11,16,20,22H,10H2,1H3,(H,21,23) |
| InChIKey | NCRVHPIRRFEPTD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |