methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate

C16H22F2N2O3 — CID 70159557

IUPACmethyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate
SMILESCCCCC(NC(=O)C(C)Nc1cc(F)cc(F)c1)C(=O)OC
InChIInChI=1S/C16H22F2N2O3/c1-4-5-6-14(16(22)23-3)20-15(21)10(2)19-13-8-11(17)7-12(18)9-13/h7-10,14,19H,4-6H2,1-3H3,(H,20,21)
InChIKeyGKOICVPABOQQSY-UHFFFAOYSA-N
MW328.36 g/mol
LogP2.61
Rot. Bonds8

About methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate

methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate (PubChem CID 70159557) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate.

Molecular Properties

Compound Namemethyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate
PubChem CID70159557
Molecular FormulaC16H22F2N2O3
Molecular Weight328.36 g/mol
Exact Mass328.16
IUPAC Namemethyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate
SMILESCCCCC(NC(=O)C(C)Nc1cc(F)cc(F)c1)C(=O)OC
InChIInChI=1S/C16H22F2N2O3/c1-4-5-6-14(16(22)23-3)20-15(21)10(2)19-13-8-11(17)7-12(18)9-13/h7-10,14,19H,4-6H2,1-3H3,(H,20,21)
InChIKeyGKOICVPABOQQSY-UHFFFAOYSA-N
XLogP2.61
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.36
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate?
The IUPAC name of methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate (CID 70159557) is methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate.
What is the SMILES notation for methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate?
The canonical SMILES for methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate is CCCCC(NC(=O)C(C)Nc1cc(F)cc(F)c1)C(=O)OC.
What is the InChIKey of methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate?
The InChIKey is GKOICVPABOQQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O3/c1-4-5-6-14(16(22)23-3)20-15(21)10(2)19-13-8-11(17)7-12(18)9-13/h7-10,14,19H,4-6H2,1-3H3,(H,20,21).
What are the key properties of methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate?
methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate has a molecular weight of 328.36 g/mol, XLogP of 2.61, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate is sourced from PubChem (CID 70159557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).