C16H22F2N2O3 — CID 70159557
methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate (PubChem CID 70159557) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate.
| Compound Name | methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 70159557 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | methyl 2-[2-(3,5-difluoroanilino)propanoylamino]hexanoate |
| SMILES | CCCCC(NC(=O)C(C)Nc1cc(F)cc(F)c1)C(=O)OC |
| InChI | InChI=1S/C16H22F2N2O3/c1-4-5-6-14(16(22)23-3)20-15(21)10(2)19-13-8-11(17)7-12(18)9-13/h7-10,14,19H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | GKOICVPABOQQSY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |