C12H23NO3 — CID 59054765
methyl (2S)-2-[[(2R)-2-methylpentanoyl]amino]pentanoate (PubChem CID 59054765) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-methylpentanoyl]amino]pentanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-methylpentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 59054765 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-methylpentanoyl]amino]pentanoate |
| SMILES | CCC[C@@H](C)C(=O)N[C@@H](CCC)C(=O)OC |
| InChI | InChI=1S/C12H23NO3/c1-5-7-9(3)11(14)13-10(8-6-2)12(15)16-4/h9-10H,5-8H2,1-4H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | VBOIWJFRTOWQAJ-ZJUUUORDSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |