C16H33NO3Si — CID 59061501
2-trimethylsilylethyl (2S)-2-[[(2S)-2-methylpentanoyl]amino]pentanoate (PubChem CID 59061501) has the molecular formula C16H33NO3Si and a molecular weight of 315.53 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S)-2-[[(2S)-2-methylpentanoyl]amino]pentanoate.
| Compound Name | 2-trimethylsilylethyl (2S)-2-[[(2S)-2-methylpentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 59061501 |
| Molecular Formula | C16H33NO3Si |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-trimethylsilylethyl (2S)-2-[[(2S)-2-methylpentanoyl]amino]pentanoate |
| SMILES | CCC[C@H](NC(=O)[C@@H](C)CCC)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C16H33NO3Si/c1-7-9-13(3)15(18)17-14(10-8-2)16(19)20-11-12-21(4,5)6/h13-14H,7-12H2,1-6H3,(H,17,18)/t13-,14-/m0/s1 |
| InChIKey | MHZCEZNHEPAVBW-KBPBESRZSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|