About 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate
2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate (PubChem CID 23547164) has the molecular formula C15H34N2O3Si
and a molecular weight of 318.53 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate |
| PubChem CID | 23547164 |
| Molecular Formula | C15H34N2O3Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate |
| SMILES | CCCC(NC(O)C(N)CCC)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C15H34N2O3Si/c1-6-8-12(16)14(18)17-13(9-7-2)15(19)20-10-11-21(3,4)5/h12-14,17-18H,6-11,16H2,1-5H3 |
| InChIKey | PQYQRXAIQNIPBN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate?
The IUPAC name of 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate (CID 23547164) is 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate.
What is the SMILES notation for 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate?
The canonical SMILES for 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate is CCCC(NC(O)C(N)CCC)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate?
The InChIKey is PQYQRXAIQNIPBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34N2O3Si/c1-6-8-12(16)14(18)17-13(9-7-2)15(19)20-10-11-21(3,4)5/h12-14,17-18H,6-11,16H2,1-5H3.
What are the key properties of 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate?
2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate has a molecular weight of 318.53 g/mol, XLogP of 2.07, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-[(2-amino-1-hydroxypentyl)amino]pentanoate is sourced from PubChem (CID 23547164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).