C12H25NO4Si — CID 162422079
2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid (PubChem CID 162422079) has the molecular formula C12H25NO4Si and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid.
| Compound Name | 2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 162422079 |
| Molecular Formula | C12H25NO4Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-[methyl(2-trimethylsilylethoxycarbonyl)amino]pentanoic acid |
| SMILES | CCCC(C(=O)O)N(C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C12H25NO4Si/c1-6-7-10(11(14)15)13(2)12(16)17-8-9-18(3,4)5/h10H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | OOILZIZRVHYCHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|